Name | Value |
---|---|
InChI=1S/C13H18O5S/c1-5-16-12-13(2,3)10-8-9(18-19(4,14)15)6-7-11(10)17-12/h6-8,12H,5H2,1-4H3 | |
IRCMYGHHKLLGHV-UHFFFAOYSA-N | |
C13H18O5S | |
286.087494676 | |
O=S(=O)(OC1=CC=C2OC(OCC)C(C2=C1)(C)C)C |
External Identifier | Value |
---|---|
26225-79-6 | |
83768 | |
C18829 | |
33360 | |
30816 |
Name | Value |
---|---|
UF401603 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
286.0875 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
24.205 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
0.7960205229848375 | |
0.38280495365202144 | |
287.0948 | |
[M+H]+ | |
2.3151795155653123 ppm | |
-6.646759999853202E-4 Da |