Name | Value |
---|---|
InChI=1S/C20H33NO/c1-15(12-21-13-16(2)22-17(3)14-21)11-18-7-9-19(10-8-18)20(4,5)6/h7-10,15-17H,11-14H2,1-6H3 | |
RYAUSSKQMZRMAI-UHFFFAOYSA-N | |
C20H33NO | |
303.256214676 | |
O1C(C)CN(CC1C)CC(C)CC2=CC=C(C=C2)C(C)(C)C |
External Identifier | Value |
---|---|
67306-03-0 | |
50148 | |
91695 | |
82798 |
Name | Value |
---|---|
UF402304 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
303.2562 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
55 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
22.432 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
2.0738455442773462 | |
0.6158786305050236 | |
304.2635 | |
[M+H]+ | |
2.2502732006687247 ppm | |
-6.846759999916685E-4 Da |