Name | Value |
---|---|
InChI=1S/C14H16ClN3O/c1-11-5-3-6-12(2)14(11)18(13(19)9-15)10-17-8-4-7-16-17/h3-8H,9-10H2,1-2H3 | |
STEPQTYSZVCJPV-UHFFFAOYSA-N | |
C14H16ClN3O | |
277.098189812 | |
O=C(N(C=1C(=CC=CC1C)C)CN2N=CC=C2)CCl |
External Identifier | Value |
---|---|
67129-08-2 | |
6798 | |
C10948 | |
49384 | |
44885 |
Name | Value |
---|---|
UF403602 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
277.0982 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
80 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
23.009 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
0.0533330169379335 | |
0.07694327905200375 | |
278.1055 | |
[M+H]+ | |
2.3725240960023264 ppm | |
-6.59811999980775E-4 Da |