Name | Value |
---|---|
InChI=1S/C11H15NO2S/c1-7-5-9(14-11(13)12-3)6-8(2)10(7)15-4/h5-6H,1-4H3,(H,12,13) | |
YFBPRJGDJKVWAH-UHFFFAOYSA-N | |
C11H15NO2S | |
225.08234972 | |
OC(=NC)OC=1C=C(C(SC)=C(C1)C)C |
External Identifier | Value |
---|---|
716-16-5 | |
38508 | |
C18651 | |
16248 | |
15417 |
Name | Value |
---|---|
UF405701 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
225.0823 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
55 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
24.497 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
1.2416070654687357 | |
0.6380598128189539 | |
226.0896 | |
[M+H]+ | |
3.183339702518022 ppm | |
-7.197200000064186E-4 Da |