Name | Value |
---|---|
InChI=1S/C15H25NO3/c1-12(2)16-10-14(17)11-19-15-6-4-13(5-7-15)8-9-18-3/h4-7,12,14,16-17H,8-11H2,1-3H3 | |
IUBSYMUCCVWXPE-UHFFFAOYSA-N | |
C15H25NO3 | |
267.18344365999997 | |
OC(COC1=CC=C(C=C1)CCOC)CNC(C)C |
External Identifier | Value |
---|---|
37350-58-6 | |
6904 | |
D02358 | |
4171 | |
4027 |
Name | Value |
---|---|
UF407204 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
267.1834 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
55 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
17.049 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
2.512626799999333 | |
0.6907401473586895 | |
268.1907 | |
[M+H]+ | |
2.661016955375299 ppm | |
-7.136599999739701E-4 Da |