Name | Value |
---|---|
InChI=1S/C14H11Cl2NO2/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h1-7,17H,8H2,(H,18,19) | |
DCOPUUMXTXDBNB-UHFFFAOYSA-N | |
C14H11Cl2NO2 | |
295.016683952 | |
O=C(O)CC=1C=CC=CC1NC=2C(Cl)=CC=CC2Cl |
External Identifier | Value |
---|---|
79183-19-0 | |
47381 | |
C01690 | |
3033 | |
2925 |
Name | Value |
---|---|
UF409354 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
295.0167 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
55 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
25.899 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
negative | |
0.0 | |
NaN | |
294.0094 | |
[M-H]- | |
0.027046754205241066 ppm | |
-7.951999975830404E-6 Da |