Name | Value |
---|---|
InChI=1S/C16H25NO2/c1-17(2)12-14-7-4-5-10-16(14,18)13-8-6-9-15(11-13)19-3/h6,8-9,11,14,18H,4-5,7,10,12H2,1-3H3/t14-,16+/m1/s1 | |
TVYLLZQTGLZFBW-ZBFHGGJFSA-N | |
C16H25NO2 | |
263.18852904 | |
OC1(C=2C=CC=C(OC)C2)CCCCC1CN(C)C |
External Identifier | Value |
---|---|
27203-92-5 | |
75725 | |
C07153 | |
33741 | |
31105 |
Name | Value |
---|---|
UF410303 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
263.1885 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
16.697 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
0.19576862583448942 | |
0.2824344256530649 | |
264.1958 | |
[M+H]+ | |
2.6459163997770916 ppm | |
-6.990399999722285E-4 Da |