Name | Value |
---|---|
InChI=1S/C18H34N2O6S/c1-5-6-10-7-11(20(3)8-10)17(25)19-12(9(2)21)16-14(23)13(22)15(24)18(26-16)27-4/h9-16,18,21-24H,5-8H2,1-4H3,(H,19,25)/t9-,10-,11+,12-,13+,14-,15-,16-,18-/m1/s1 | |
OJMMVQQUTAEWLP-KIDUDLJLSA-N | |
C18H34N2O6S | |
406.21375780799997 | |
OC(=NC(C(O)C)C1OC(SC)C(O)C(O)C1O)C2N(C)CC(CCC)C2 |
External Identifier | Value |
---|---|
154-21-2 | |
6472 | |
D00223 | |
3000540 | |
2272112 |
Name | Value |
---|---|
2017.01.05 | |
UF410551 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
406.2138 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
55 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
13.675 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
negative | |
0.9787782479129405 | |
0.8909223554194459 | |
405.2065 | |
[M-H]- | |
0.044895627358603425 ppm | |
1.819200002728394E-5 Da |