Name | Value |
---|---|
InChI=1S/C9H17NO2/c10-7-9(6-8(11)12)4-2-1-3-5-9/h1-7,10H2,(H,11,12) | |
UGJMXCAKCUNAIE-UHFFFAOYSA-N | |
C9H17NO2 | |
171.125928784 | |
O=C(O)CC1(CN)CCCCC1 |
External Identifier | Value |
---|---|
360-70-3 | |
42797 | |
D00332 | |
3446 | |
3328 |
Name | Value |
---|---|
UF411402 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
171.1259 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
80 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
11.872 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
2.110600421232652 | |
0.8493680925248109 | |
172.1332 | |
[M+H]+ | |
4.059553880412904 ppm | |
-6.987840000078904E-4 Da |