Name | Value |
---|---|
InChI=1S/C4H7N3O/c1-7-2-3(8)6-4(7)5/h2H2,1H3,(H2,5,6,8) | |
DDRJAANPRJIHGJ-UHFFFAOYSA-N | |
C4H7N3O | |
113.058911844 | |
N=C1N=C(O)CN1C |
External Identifier | Value |
---|---|
60-27-5 | |
16737 | |
C00791 | |
588 | |
568 |
Name | Value |
---|---|
114.0662 | |
[M+H]+ | |
UF412504 | |
2019-11-08 considered noisy | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
113.0589 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
55 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
2.036 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
0.37230824728676276 | |
0.3388895710770962 | |
5.977616506896279 ppm | |
-6.818439999989323E-4 Da |