Name | Value |
---|---|
InChI=1S/C8H10N2O/c1-6(11)10-8-4-2-7(9)3-5-8/h2-5H,9H2,1H3,(H,10,11) | |
CHMBIJAOCISYEW-UHFFFAOYSA-N | |
C8H10N2O | |
150.07931294 | |
OC(=NC1=CC=C(N)C=C1)C |
External Identifier | Value |
---|---|
122-80-5 | |
31230 | |
10297844 |
Name | Value |
---|---|
UF413504 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
150.0793 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
55 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
2.292 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
0.7913161206182346 | |
0.4066560426761725 | |
151.0866 | |
[M+H]+ | |
4.520189083546389 ppm | |
-6.829399999901398E-4 Da |