Name | Value |
---|---|
InChI=1S/C6H6ClN/c7-5-1-3-6(8)4-2-5/h1-4H,8H2 | |
QSNSCYSYFYORTR-UHFFFAOYSA-N | |
C6H6ClN | |
127.01887687199999 | |
ClC1=CC=C(N)C=C1 |
External Identifier | Value |
---|---|
106-47-8 | |
20331 | |
C14450 | |
7812 | |
13869339 |
Name | Value |
---|---|
UF413802 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
127.0189 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
80 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
8.827 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
1.0823753619702328 | |
0.6040851914328397 | |
128.0262 | |
[M+H]+ | |
5.052653285064701 ppm | |
-6.468720000043504E-4 Da |