Name | Value |
---|---|
InChI=1S/C17H20N2O/c1-18(2)15-9-5-13(6-10-15)17(20)14-7-11-16(12-8-14)19(3)4/h5-12H,1-4H3 | |
VVBLNCFGVYUYGU-UHFFFAOYSA-N | |
C17H20N2O | |
268.15756326 | |
O=C(C1=CC=C(C=C1)N(C)C)C2=CC=C(C=C2)N(C)C |
External Identifier | Value |
---|---|
96-98-0 | |
82347 | |
C19266 | |
7031 | |
6764 |
Name | Value |
---|---|
UF414402 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
268.1576 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
80 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
25.805 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
1.0174410010617965 | |
0.48928569554298545 | |
269.1648 | |
[M+H]+ | |
2.7242046508461195 ppm | |
-7.332600000040657E-4 Da |