Name | Value |
---|---|
InChI=1S/C10H17N/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6,11H2 | |
DKNWSYNQZKUICI-UHFFFAOYSA-N | |
C10H17N | |
151.136099544 | |
NC12CC3CC(CC(C3)C1)C2 |
External Identifier | Value |
---|---|
768-94-5 | |
2618 | |
D07441 | |
2130 | |
2045 |
Name | Value |
---|---|
2017.01.05 | |
UF414701 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
151.1361 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
55 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
15.657 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
0.49803468602660633 | |
0.7185121717212769 | |
152.1434 | |
[M+H]+ | |
4.400742983106632 ppm | |
-6.695439999759856E-4 Da |