Name | Value |
---|---|
InChI=1S/C9H10O3/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6,10H,2H2,1H3 | |
NUVBSKCKDOMJSU-UHFFFAOYSA-N | |
C9H10O3 | |
166.06299417999998 | |
O=C(OCC)C1=CC=C(O)C=C1 |
External Identifier | Value |
---|---|
121-58-4 | |
31575 | |
D01647 | |
8434 | |
13846749 |
Name | Value |
---|---|
UF415601 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
166.063 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
55 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
21.860 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
1.2240286461278036 | |
0.7605317587409092 | |
167.0703 | |
[M+H]+ | |
3.975452249578187 ppm | |
-6.641799999727027E-4 Da |