Name | Value |
---|---|
InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1 | |
MUMGGOZAMZWBJJ-DYKIIFRCSA-N | |
C19H28O2 | |
288.208930136 | |
O=C1C=C2CCC3C(CCC4(C)C(O)CCC34)C2(C)CC1 |
External Identifier | Value |
---|---|
LMST02020002 | |
58-22-0 | |
17347 | |
D00075 | |
6013 | |
5791 |
Name | Value |
---|---|
UF416002 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
288.2089 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
80 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
24.975 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
2.212858354592177 | |
0.6328767536438777 | |
289.2162 | |
[M+H]+ | |
2.4208049202556663 ppm | |
-7.001359999776469E-4 Da |