Name | Value |
---|---|
InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19/h1-7,16-18H | |
TZBJGXHYKVUXJN-UHFFFAOYSA-N | |
C15H10O5 | |
270.05282342 | |
O=C1C(=COC=2C=C(O)C=C(O)C12)C=3C=CC(O)=CC3 |
External Identifier | Value |
---|---|
152-95-4 | |
28088 | |
C06563 | |
LMPK12050218 | |
5280961 | |
4444448 |
Name | Value |
---|---|
CC BY | |
UF416202 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
Copyright (C) 2017 | |
270.0528 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
80 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
22.703 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
3.1147583284198435 | |
0.7882982043785701 | |
271.0601 | |
[M+H]+ | |
2.5581780572080053 ppm | |
-6.934200000046076E-4 Da |