Name | Value |
---|---|
InChI=1S/C19H26O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-16H,3-10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 | |
AEMFNILZOJDQLW-QAGGRKNESA-N | |
C19H26O2 | |
286.193280072 | |
O=C1C=C2CCC3C4CCC(=O)C4(C)CCC3C2(C)CC1 |
External Identifier | Value |
---|---|
63-05-8 | |
16422 | |
C00280 | |
LMST02020007 | |
6128 | |
5898 |
Name | Value |
---|---|
UF416502 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
286.1933 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
80 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
24.312 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
2.1281154893046583 | |
0.6034877813681006 | |
287.2006 | |
[M+H]+ | |
2.2634771653851087 ppm | |
-6.500719999849025E-4 Da |