Name | Value |
---|---|
InChI=1S/C6H5N3/c1-2-4-6-5(3-1)7-9-8-6/h1-4H,(H,7,8,9) | |
QRUDEWIWKLJBPS-UHFFFAOYSA-N | |
C6H5N3 | |
119.04834715999999 | |
N1=NC=2C=CC=CC2N1 |
External Identifier | Value |
---|---|
95-14-7 | |
75331 | |
7220 | |
6950 |
Name | Value |
---|---|
UF417701 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
119.0483 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
55 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
16.478 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
0.14888385220162598 | |
0.21479399523973117 | |
120.0556 | |
[M+H]+ | |
5.973565581226992 ppm | |
-7.171599999935552E-4 Da |