Name | Value |
---|---|
InChI=1S/C10H8O3/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9/h2-5,11H,1H3 | |
HSHNITRMYYLLCV-UHFFFAOYSA-N | |
C10H8O3 | |
176.04734411599998 | |
O=C1OC=2C=C(O)C=CC2C(=C1)C |
External Identifier | Value |
---|---|
90-33-5 | |
17224 | |
D00170 | |
5280567 | |
4444190 |
Name | Value |
---|---|
UF419352 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
176.0473 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
80 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
20.052 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
negative | |
0.0 | |
NaN | |
175.0401 | |
[M-H]- | |
0.18215254681119278 ppm | |
3.188400000908587E-5 Da |