Name | Value |
---|---|
InChI=1S/C12H23NO3/c1-3-10(2)16-12(15)13-8-5-4-6-11(13)7-9-14/h10-11,14H,3-9H2,1-2H3 | |
QLHULAHOXSSASE-UHFFFAOYSA-N | |
C12H23NO3 | |
229.16779359599997 | |
O=C(OC(C)CC)N1CCCCC1CCO |
External Identifier | Value |
---|---|
119515-38-7 | |
125098 | |
111359 |
Name | Value |
---|---|
2017.01.05 | |
UF420703 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
229.1678 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
23.925 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
1.001362987132227 | |
0.9114798709799778 | |
230.1751 | |
[M+H]+ | |
2.883005155558641 ppm | |
-6.635959999812258E-4 Da |