Name | Value |
---|---|
Natural Product; Fungal metabolite | |
InChI=1S/C34H59NO14/c1-5-6-12-21(3)32(49-31(43)18-24(34(46)47)16-29(40)41)27(48-30(42)17-23(33(44)45)15-28(38)39)14-20(2)11-9-7-8-10-13-25(36)19-26(37)22(4)35/h20-27,32,36-37H,5-19,35H2,1-4H3,(H,38,39)(H,40,41)(H,44,45)(H,46,47)/t20-,21+,22-,23+,24+,25+,26-,27-,32+/m0/s1 | |
UXDPXZQHTDAXOZ-STOIETHLSA-N | |
C34H59NO14 | |
705.393555568 | |
O=C(O)CC(C(=O)O)CC(=O)OC(CC(C)CCCCCCC(O)CC(O)C(N)C)C(OC(=O)CC(C(=O)O)CC(=O)O)C(C)CCCC |
External Identifier | Value |
---|---|
116355-84-1 | |
2733489 | |
2015284 |
Name | Value |
---|---|
AC000485 | |
2017.07.07 | |
Justin B. Renaud, Mark W. Sumarah, Agriculture and Agri-Food Canada | |
CC BY-SA | |
Copyright (C) 2017 | |
Renaud, J. B.; Sumarah, M. W. Data Independent Acquisition-Digital Archiving Mass Spectrometry: Application to Single Kernel Mycotoxin Analysis of Fusarium Graminearum Infected Maize. Analytical and Bioanalytical Chemistry 2016, 408 (12), 3083–91. DOI:10.1007/s00216-016-9391-5 | |
CONFIDENCE Reference Standard (Level 1) | |
705.39354 | |
Q-Exactive Orbitrap Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
3.9 kV | |
HCD | |
10(NCE) | |
17500 | |
Agilent RRHD Eclipse 50 x 2 mm, 1.8 uM | |
100:0 at 0 min, 100:0 at 0.5 min, 0:100 at 3.5 min, 0:100 at 5.5 min, 100:0 at 7 min | |
0.3 mL min-1 | |
2.88 | |
794 | |
H2O 0.1% FA | |
ACN 0.1% FA | |
Proteowizard | |
based on Fragment ion formula determination | |
CUTOFF 0.05 Base Peak | |
positive | |
0.0 | |
NaN | |
728.3822 | |
[M+Na]+ | |
1.54529860836851 ppm | |
-0.0011255680000203938 Da |