Name | Value |
---|---|
6036 | |
InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3+,4+,5-,6?/m1/s1 | |
WQZGKKKJIJFFOK-SVZMEOIVSA-N | |
C6H12O6 | |
180.06338810399998 | |
OCC1OC(O)C(O)C(O)C1O |
Name | Value |
---|---|
070502bmplib10 | |
658715 | |
minor | |
5 TMS; 1 MEOX | |
569.288 | |
MS1 | |
Leco Pegasus IV | |
GC-EI-TOF | |
250C | |
230C | |
-70 eV | |
80-500 Da | |
Restek Corporation Rtx-5Sil MS (30 m length x 0.25 mm internal diameter with 0.25 µm film made of 95% dimethyl/5%diphenylpolysiloxane) | |
10m | |
helium | |
50-330°C | |
1 mL min-1 | |
0.5 µL | |
25 splitless time into a multi-baffled glass liner | |
50°C ramped to 250°C by 12°C s-1 | |
50°C for 1 min, then ramped at 20°C min-1 to 330°C, held constant for 5 min. | |
1800 V | |
positive | |
3.625455334812375 | |
0.7004154675041878 |