Name | Value |
---|---|
Natural Product | |
InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1 | |
AYFVYJQAPQTCCC-GBXIJSLDSA-N | |
C4H9NO3 | |
119.05824314799999 | |
O=C(O)C(N)C(O)C |
Name | Value |
---|---|
GLS00036 | |
2016.01.19 (Created 2012.08.03, modified 2013.07.31) | |
Miyagawa H, Akimoto S, Yamasaki K, GL Sciences Inc. | |
CC BY-SA | |
GL Sciences Inc. | |
The chemical compound was chemically modified with N-methyl-N-trimethylsilyl-trifluoroacetamide(MSTFA) before GC-MS analysis. When it has two or more functional groups, this modification gave a mixture of the TMS derivatives having different number of TMS groups at different functional groups. | |
119.05824 | |
GCMS-2010 Plus, Shimadzu | |
EI-B | |
MS1 | |
75 kPa | |
200 C | |
85-500 | |
InertCap 5MS/NP 0.25 mmI.D. x 30 m, df=0.25 um | |
230 C | |
80 C(2 min)-15 C/min - 330C | |
1302 | |
465.17 | |
250 C | |
2 TMS | |
GCMSsolution | |
positive | |
2.9956647215694234 | |
0.5070451367931977 |