Name | Value |
---|---|
InChI=1S/C6H7N5O/c1-11-2-8-4-3(11)5(12)10-6(7)9-4/h2H,1H3,(H3,7,9,10,12) | |
FZWGECJQACGGTI-UHFFFAOYSA-N | |
C6H7N5O | |
165.065059844 | |
N=C1N=C(O)C2=C(N=CN2C)N1 |
Name | Value |
---|---|
2.98 | |
10 | |
C6H7N5O | |
Centroid | |
Isabel Meister, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
CC-BY | |
MS2 | |
ESI | |
DDA | |
Merck SeQuant ZIC pHILIC Guard column (2.1 mm x 20 mm, 5 µm particle size) with Merck SeQuant ZIC pHILIC (2.1 x 100 mm, 5 µm particle size, 100 Å) | |
12/88 at 0 min, 40/60 at 8.5 min, 75/25 at 8.7-11.2 min; 12/88 at 11.5-22 min | |
0.28ml/min | |
5 mM ammonium acetate in water with 0.04% NH4OH (pH 9.3) | |
acetonitrile | |
NEG_2020-11-24_V01B_RCH_LC06_tDDA_ChemSTD_219_CPD_Meister2020_OPEN.msp | |
negative | |
1.692984957136385 | |
0.6600461534304475 | |
164.05778503418 | |
[M-H]- | |
0.007254638970825706 ppm | |
1.1901800007763086E-6 Da |