Name | Value |
---|---|
Natural Product; Nucleoside; Phosphates | |
InChI=1S/C10H14N4O11P2/c15-6-4(1-23-27(21,22)25-26(18,19)20)24-10(7(6)16)14-3-13-5-8(14)11-2-12-9(5)17/h2-4,6-7,10,15-16H,1H2,(H,21,22)(H,11,12,17)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 | |
JPXZQMKKFWMMGK-KQYNXXCUSA-N | |
C10H14N4O11P2 | |
428.01343052799996 | |
O=P(O)(O)OP(=O)(O)OCC1OC(N2C=NC=3C(O)=NC=NC32)C(O)C1O |
External Identifier | Value |
---|---|
86-04-4 | |
6570 | |
C00104 | |
6831 |
Name | Value |
---|---|
PR100572 | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
428.01343 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
420 C | |
LOW-ENERGY CID | |
ESI | |
1.0 sec/scan (m/z = 50-1000) | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH) / H2O(0.1%HCOOH) | |
negative | |
1.8682179967127477 | |
0.8113567669646937 | |
427.00563 | |
[M-H]- | |
1.228386613945276 ppm | |
-5.245279999712693E-4 Da |