Name | Value |
---|---|
InChI=1S/C27H40O5/c1-16(28)26-10-6-5-7-18(26)13-22-20-14-23(30)27(31)15-19(32-17(2)29)8-11-25(27,4)21(20)9-12-24(22,26)3/h18-22,31H,5-15H2,1-4H3 | |
DMAXEADUOQCSHM-UHFFFAOYSA-N | |
C27H40O5 | |
444.28757437999997 | |
O=C(OC1CCC2(C)C3CCC4(C)C(CC5CCCCC54C(=O)C)C3CC(=O)C2(O)C1)C |
External Identifier | Value |
---|---|
21474589 | |
4008455 |
Name | Value |
---|---|
BML00013 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 1.476 | |
444.287574 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
10 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
10.846 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
positive | |
0.20734292102444027 | |
0.299132603925392 | |
467.2768 | |
[M+Na]+ | |
1.165005410086708 ppm | |
-5.443800000080046E-4 Da |