Name | Value |
---|---|
InChI=1S/C11H16N2O2/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2/h5,7-8,10H,3-4,6H2,1-2H3/t8-,10-/m0/s1 | |
QCHFTSOMWOSFHM-WPRPVWTQSA-N | |
C11H16N2O2 | |
208.121177752 | |
O=C1OCC(CC2=CN=CN2C)C1CC |
External Identifier | Value |
---|---|
54-71-7 | |
5699 | |
5910 |
Name | Value |
---|---|
BML81955 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 0.052 | |
208.121178 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS1 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
0.387 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
positive | |
0.01330309839514899 | |
0.019192314083139376 |