Name | Value |
---|---|
3084028 | |
InChI=1S/C8H15NO6.H2O/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14;/h4-8,10,12-14H,2H2,1H3,(H,9,11);1H2 | |
VVQPUTSNIMAJPT-UHFFFAOYSA-N | |
C8H17NO7 | |
239.10050188399998 | |
O.OC(=NC1C(O)OC(CO)C(O)C1O)C |
Name | Value |
---|---|
730497 | |
minor 1 | |
5 TMS | |
599.298 | |
MS1 | |
Leco Pegasus IV | |
GC-EI-TOF | |
250C | |
230C | |
-70 eV | |
80-500 Da | |
10m | |
helium | |
Restek Corporation Rtx-5Sil MS (30 m length x 0.25 mm internal diameter with 0.25 µm film made of 95% dimethyl/5%diphenylpolysiloxane) | |
50-330°C | |
1 mL min-1 | |
0.5 µL | |
25 splitless time into a multi-baffled glass liner | |
50°C ramped to 250°C by 12°C s-1 | |
50°C for 1 min, then ramped at 20°C min-1 to 330°C, held constant for 5 min. | |
1800 V | |
positive | |
4.073612899909822 | |
0.7533722012329949 |