Name | Value |
---|---|
Natural Product; Nucleoside; Phosphates | |
InChI=1S/C9H12N3O7P/c10-5-1-2-12(9(14)11-5)8-6(13)7-4(18-8)3-17-20(15,16)19-7/h1-2,4,6-8,13H,3H2,(H,15,16)(H2,10,11,14)/t4-,6-,7-,8-/m1/s1 | |
WCPTXJJVVDAEMW-XVFCMESISA-N | |
C9H12N3O7P | |
305.041286354 | |
O=P1(O)OCC2OC(N3C=CC(=N)N=C3O)C(O)C2O1 |
External Identifier | Value |
---|---|
3616-08-8 | |
18153 | |
C00941 | |
19236 |
Name | Value |
---|---|
PR100118 | |
2016.01.19 (Created 2009.09.10, modified 2011.05.06) | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
305.04129 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
30 V | |
Continuum | |
600.0 L/Hr | |
400 C | |
LOW-ENERGY CID | |
ESI | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
positive | |
0.8015100683631204 | |
0.7295659047604702 | |
306.04909 | |
[M+H]+ | |
0.543553323565221 ppm | |
-1.6635400004361145E-4 Da |