Name | Value |
---|---|
InChI=1S/C5H8ClN5/c1-2-8-5-10-3(6)9-4(7)11-5/h2H2,1H3,(H3,7,8,9,10,11) | |
IVENSCMCQBJAKW-UHFFFAOYSA-N | |
C5H8ClN5 | |
173.046822936 | |
ClC1=NC(=N)NC(=NCC)N1 |
External Identifier | Value |
---|---|
1007-28-9 | |
27399 | |
C06556 | |
13878 | |
13278 |
Name | Value |
---|---|
UF403004 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
173.0468 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
55 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
16.341 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
1.6849505625951118 | |
0.7317647316148367 | |
174.0541 | |
[M+H]+ | |
3.981152986382934 ppm | |
-6.929360000071938E-4 Da |