Name | Value |
---|---|
InChI=1S/C11H12Cl2N2O5/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20/h1-4,8-10,16-17H,5H2,(H,14,18) | |
WIIZWVCIJKGZOK-UHFFFAOYSA-N | |
C11H12Cl2N2O5 | |
322.012326844 | |
O=N(=O)C1=CC=C(C=C1)C(O)C(N=C(O)C(Cl)Cl)CO |
External Identifier | Value |
---|---|
56-75-7 | |
298 | |
292 |
Name | Value |
---|---|
UF407302 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
322.0123 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
80 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
19.347 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
0.9645747624194159 | |
0.8779937857684145 | |
323.0196 | |
[M+H]+ | |
2.157280858334448 ppm | |
-6.968439999468501E-4 Da |